C26H47N7O6 — CID 144842630
ethane;formamide;[4-[[5-(methylamino)-2-[[3-methyl-2-(methylcarbamoylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl N-ethylcarbamate (PubChem CID 144842630) has the molecular formula C26H47N7O6 and a molecular weight of 553.71 g/mol. Its IUPAC name is ethane;formamide;[4-[[5-(methylamino)-2-[[3-methyl-2-(methylcarbamoylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl N-ethylcarbamate.
| Compound Name | ethane;formamide;[4-[[5-(methylamino)-2-[[3-methyl-2-(methylcarbamoylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 144842630 |
| Molecular Formula | C26H47N7O6 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.36 |
| IUPAC Name | ethane;formamide;[4-[[5-(methylamino)-2-[[3-methyl-2-(methylcarbamoylamino)butanoyl]amino]pentanoyl]amino]phenyl]methyl N-ethylcarbamate |
| SMILES | CC.CCNC(=O)OCc1ccc(NC(=O)C(CCCNC)NC(=O)C(NC(=O)NC)C(C)C)cc1.NC=O |
| InChI | InChI=1S/C23H38N6O5.C2H6.CH3NO/c1-6-26-23(33)34-14-16-9-11-17(12-10-16)27-20(30)18(8-7-13-24-4)28-21(31)19(15(2)3)29-22(32)25-5;1-2;2-1-3/h9-12,15,18-19,24H,6-8,13-14H2,1-5H3,(H,26,33)(H,27,30)(H,28,31)(H2,25,29,32);1-2H3;1H,(H2,2,3) |
| InChIKey | TZRNBUZHYUCHFO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 192.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|