C26H44N6O6 — CID 126714030
[4-[[5-[[amino(hydroxy)methyl]amino]-2-[[2-(2,2-dimethylpropanoylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-ethylcarbamate (PubChem CID 126714030) has the molecular formula C26H44N6O6 and a molecular weight of 536.67 g/mol. Its IUPAC name is [4-[[5-[[amino(hydroxy)methyl]amino]-2-[[2-(2,2-dimethylpropanoylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-ethylcarbamate.
| Compound Name | [4-[[5-[[amino(hydroxy)methyl]amino]-2-[[2-(2,2-dimethylpropanoylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 126714030 |
| Molecular Formula | C26H44N6O6 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | [4-[[5-[[amino(hydroxy)methyl]amino]-2-[[2-(2,2-dimethylpropanoylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCc1ccc(NC(=O)C(CCCNC(N)O)NC(=O)C(NC(=O)C(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C26H44N6O6/c1-7-28-25(37)38-15-17-10-12-18(13-11-17)30-21(33)19(9-8-14-29-24(27)36)31-22(34)20(16(2)3)32-23(35)26(4,5)6/h10-13,16,19-20,24,29,36H,7-9,14-15,27H2,1-6H3,(H,28,37)(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | AWJLTOKOXDIEBR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 183.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|