C24H39N5O5 — CID 126571314
[4-[[(2S)-2-[[2-(tert-butylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate (PubChem CID 126571314) has the molecular formula C24H39N5O5 and a molecular weight of 477.61 g/mol. Its IUPAC name is [4-[[(2S)-2-[[2-(tert-butylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[(2S)-2-[[2-(tert-butylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 126571314 |
| Molecular Formula | C24H39N5O5 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | [4-[[(2S)-2-[[2-(tert-butylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)C(NC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C24H39N5O5/c1-15(2)20(29-24(4,5)6)22(32)28-19(8-7-13-26-23(25)33)21(31)27-18-11-9-17(10-12-18)14-34-16(3)30/h9-12,15,19-20,29H,7-8,13-14H2,1-6H3,(H,27,31)(H,28,32)(H3,25,26,33)/t19-,20?/m0/s1 |
| InChIKey | KJADTAJSUYKKGF-XJDOXCRVSA-N |
| XLogP | 2.03 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|