C28H45N7O7 — CID 126540205
[4-[[(2S)-2-[[2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate (PubChem CID 126540205) has the molecular formula C28H45N7O7 and a molecular weight of 591.71 g/mol. Its IUPAC name is [4-[[(2S)-2-[[2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[(2S)-2-[[2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 126540205 |
| Molecular Formula | C28H45N7O7 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.34 |
| IUPAC Name | [4-[[(2S)-2-[[2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)NC(C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(C)=O)cc1)C(C)C |
| InChI | InChI=1S/C28H45N7O7/c1-17(2)24(35-26(39)22(32-18(3)36)8-5-6-14-29)27(40)34-23(9-7-15-31-28(30)41)25(38)33-21-12-10-20(11-13-21)16-42-19(4)37/h10-13,17,22-24H,5-9,14-16,29H2,1-4H3,(H,32,36)(H,33,38)(H,34,40)(H,35,39)(H3,30,31,41)/t22-,23-,24?/m0/s1 |
| InChIKey | VKLRVCSTXLDDKJ-NTZARQNWSA-N |
| XLogP | 0.40 |
| TPSA | 223.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|