C24H34BN5O8 — CID 174100537
CID 174100537 (PubChem CID 174100537) has the molecular formula C24H34BN5O8 and a molecular weight of 531.38 g/mol.
| Compound Name | CID 174100537 |
|---|---|
| PubChem CID | 174100537 |
| Molecular Formula | C24H34BN5O8 |
| Molecular Weight | 531.38 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | — |
| SMILES | [B]C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)C(NC(=O)CCCC(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C24H34BN5O8/c1-14(2)20(30-18(31)6-3-7-19(32)33)22(35)29-17(5-4-12-27-24(26)37)21(34)28-16-10-8-15(9-11-16)13-38-23(25)36/h8-11,14,17,20H,3-7,12-13H2,1-2H3,(H,28,34)(H,29,35)(H,30,31)(H,32,33)(H3,26,27,37)/t17-,20?/m0/s1 |
| InChIKey | NKILKZUFCYWDBH-DIMJTDRSSA-N |
| XLogP | 0.76 |
| TPSA | 206.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|