C30H43BN6O8 — CID 174007750
CID 174007750 (PubChem CID 174007750) has the molecular formula C30H43BN6O8 and a molecular weight of 626.52 g/mol.
| Compound Name | CID 174007750 |
|---|---|
| PubChem CID | 174007750 |
| Molecular Formula | C30H43BN6O8 |
| Molecular Weight | 626.52 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | — |
| SMILES | [B]C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)C(NC(=O)CCCCCN2C(=O)CC(C)C2=O)C(C)C)cc1 |
| InChI | InChI=1S/C30H43BN6O8/c1-18(2)25(36-23(38)9-5-4-6-15-37-24(39)16-19(3)28(37)42)27(41)35-22(8-7-14-33-30(32)44)26(40)34-21-12-10-20(11-13-21)17-45-29(31)43/h10-13,18-19,22,25H,4-9,14-17H2,1-3H3,(H,34,40)(H,35,41)(H,36,38)(H3,32,33,44)/t19?,22-,25?/m0/s1 |
| InChIKey | SONONPBMQVXVKQ-WQNVSQMQSA-N |
| XLogP | 1.46 |
| TPSA | 206.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.52 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|