C23H39N5O6 — CID 76625187
N-[1-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanamide (PubChem CID 76625187) has the molecular formula C23H39N5O6 and a molecular weight of 481.59 g/mol. Its IUPAC name is N-[1-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanamide.
| Compound Name | N-[1-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanamide |
|---|---|
| PubChem CID | 76625187 |
| Molecular Formula | C23H39N5O6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | N-[1-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanamide |
| SMILES | CC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)CCCCCN1C(=O)CC(C)C1=O)C(C)C |
| InChI | InChI=1S/C23H39N5O6/c1-14(2)20(21(32)26-17(16(4)29)9-8-11-25-23(24)34)27-18(30)10-6-5-7-12-28-19(31)13-15(3)22(28)33/h14-15,17,20H,5-13H2,1-4H3,(H,26,32)(H,27,30)(H3,24,25,34) |
| InChIKey | BSKBWFOOAVELJL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|