C24H45N5O5 — CID 129102432
N-[(2S)-1-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2-ethylbutanoylamino)hexanamide (PubChem CID 129102432) has the molecular formula C24H45N5O5 and a molecular weight of 483.65 g/mol. Its IUPAC name is N-[(2S)-1-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2-ethylbutanoylamino)hexanamide.
| Compound Name | N-[(2S)-1-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2-ethylbutanoylamino)hexanamide |
|---|---|
| PubChem CID | 129102432 |
| Molecular Formula | C24H45N5O5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.34 |
| IUPAC Name | N-[(2S)-1-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2-ethylbutanoylamino)hexanamide |
| SMILES | CCC(CC)C(=O)NCCCCCC(=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(C)=O)C(C)C |
| InChI | InChI=1S/C24H45N5O5/c1-6-18(7-2)22(32)26-14-10-8-9-13-20(31)29-21(16(3)4)23(33)28-19(17(5)30)12-11-15-27-24(25)34/h16,18-19,21H,6-15H2,1-5H3,(H,26,32)(H,28,33)(H,29,31)(H3,25,27,34)/t19-,21-/m0/s1 |
| InChIKey | CGXXWLPHVNYYCI-FPOVZHCZSA-N |
| XLogP | 1.76 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|