C19H33Br2N5O5 — CID 139458300
6-[[3-bromo-2-(bromomethyl)propanoyl]amino]-N-[2-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]hexanamide (PubChem CID 139458300) has the molecular formula C19H33Br2N5O5 and a molecular weight of 571.31 g/mol. Its IUPAC name is 6-[[3-bromo-2-(bromomethyl)propanoyl]amino]-N-[2-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]hexanamide.
| Compound Name | 6-[[3-bromo-2-(bromomethyl)propanoyl]amino]-N-[2-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 139458300 |
| Molecular Formula | C19H33Br2N5O5 |
| Molecular Weight | 571.31 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | 6-[[3-bromo-2-(bromomethyl)propanoyl]amino]-N-[2-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]hexanamide |
| SMILES | CC(=O)[C@H](CCCNC(N)=O)NC(=O)CNC(=O)CCCCCNC(=O)C(CBr)CBr |
| InChI | InChI=1S/C19H33Br2N5O5/c1-13(27)15(6-5-9-24-19(22)31)26-17(29)12-25-16(28)7-3-2-4-8-23-18(30)14(10-20)11-21/h14-15H,2-12H2,1H3,(H,23,30)(H,25,28)(H,26,29)(H3,22,24,31)/t15-/m0/s1 |
| InChIKey | GNMSCRWKCWBLTC-HNNXBMFYSA-N |
| XLogP | 0.71 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|