C19H35N5O7 — CID 139458514
(2S)-5-(carbamoylamino)-2-[[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]acetyl]amino]pentanoic acid (PubChem CID 139458514) has the molecular formula C19H35N5O7 and a molecular weight of 445.52 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(carbamoylamino)-2-[[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 139458514 |
| Molecular Formula | C19H35N5O7 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]acetyl]amino]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)NCC(=O)N[C@@H](CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H35N5O7/c1-19(2,3)31-18(30)22-10-6-4-5-9-14(25)23-12-15(26)24-13(16(27)28)8-7-11-21-17(20)29/h13H,4-12H2,1-3H3,(H,22,30)(H,23,25)(H,24,26)(H,27,28)(H3,20,21,29)/t13-/m0/s1 |
| InChIKey | MZAUSYFDOKVUMN-ZDUSSCGKSA-N |
| XLogP | 0.21 |
| TPSA | 188.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|