C17H32N4O6 — CID 166829349
(2S)-6-(carbamoylamino)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]hexanoic acid (PubChem CID 166829349) has the molecular formula C17H32N4O6 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2S)-6-(carbamoylamino)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-(carbamoylamino)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 166829349 |
| Molecular Formula | C17H32N4O6 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (2S)-6-(carbamoylamino)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]hexanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](CCCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H32N4O6/c1-10(2)12(21-16(26)27-17(3,4)5)13(22)20-11(14(23)24)8-6-7-9-19-15(18)25/h10-12H,6-9H2,1-5H3,(H,20,22)(H,21,26)(H,23,24)(H3,18,19,25)/t11-,12-/m0/s1 |
| InChIKey | GOLCERDFDDOPKB-RYUDHWBXSA-N |
| XLogP | 0.94 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|