C19H38N4O4 — CID 129302870
tert-butyl (2S)-2-[[(2S)-2-(tert-butylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoate (PubChem CID 129302870) has the molecular formula C19H38N4O4 and a molecular weight of 386.54 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-(tert-butylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-(tert-butylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoate |
|---|---|
| PubChem CID | 129302870 |
| Molecular Formula | C19H38N4O4 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-(tert-butylamino)-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoate |
| SMILES | CC(C)[C@H](NC(C)(C)C)C(=O)N[C@@H](CCCNC(N)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H38N4O4/c1-12(2)14(23-18(3,4)5)15(24)22-13(10-9-11-21-17(20)26)16(25)27-19(6,7)8/h12-14,23H,9-11H2,1-8H3,(H,22,24)(H3,20,21,26)/t13-,14-/m0/s1 |
| InChIKey | KSJZFBUNZWHKQR-KBPBESRZSA-N |
| XLogP | 1.67 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|