C25H50N4O3 — CID 129103746
N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-3-methyl-2-(2-methylnonan-2-ylamino)butanamide (PubChem CID 129103746) has the molecular formula C25H50N4O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-3-methyl-2-(2-methylnonan-2-ylamino)butanamide.
| Compound Name | N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-3-methyl-2-(2-methylnonan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 129103746 |
| Molecular Formula | C25H50N4O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.39 |
| IUPAC Name | N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-3-methyl-2-(2-methylnonan-2-ylamino)butanamide |
| SMILES | CCCCCCCC(C)(C)NC(C(=O)NC(CCCNC(N)=O)C(=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C25H50N4O3/c1-9-10-11-12-13-16-25(7,8)29-20(18(2)3)22(31)28-19(21(30)24(4,5)6)15-14-17-27-23(26)32/h18-20,29H,9-17H2,1-8H3,(H,28,31)(H3,26,27,32) |
| InChIKey | MHUXIYTWROOIPP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|