C17H34N4O3 — CID 178033897
N-[1-(carbamoylamino)-5-oxooctan-4-yl]-3-methyl-2-(propan-2-ylamino)butanamide (PubChem CID 178033897) has the molecular formula C17H34N4O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is N-[1-(carbamoylamino)-5-oxooctan-4-yl]-3-methyl-2-(propan-2-ylamino)butanamide.
| Compound Name | N-[1-(carbamoylamino)-5-oxooctan-4-yl]-3-methyl-2-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 178033897 |
| Molecular Formula | C17H34N4O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | N-[1-(carbamoylamino)-5-oxooctan-4-yl]-3-methyl-2-(propan-2-ylamino)butanamide |
| SMILES | CCCC(=O)C(CCCNC(N)=O)NC(=O)C(NC(C)C)C(C)C |
| InChI | InChI=1S/C17H34N4O3/c1-6-8-14(22)13(9-7-10-19-17(18)24)21-16(23)15(11(2)3)20-12(4)5/h11-13,15,20H,6-10H2,1-5H3,(H,21,23)(H3,18,19,24) |
| InChIKey | GJGKHDAHGLYIHK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|