C15H30N4O3S2 — CID 155014082
(2S)-2-[bis(sulfanyl)methylamino]-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-methylbutanamide (PubChem CID 155014082) has the molecular formula C15H30N4O3S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is (2S)-2-[bis(sulfanyl)methylamino]-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-[bis(sulfanyl)methylamino]-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 155014082 |
| Molecular Formula | C15H30N4O3S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (2S)-2-[bis(sulfanyl)methylamino]-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-methylbutanamide |
| SMILES | CC(C)C(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(S)S)C(C)C |
| InChI | InChI=1S/C15H30N4O3S2/c1-8(2)11(19-15(23)24)13(21)18-10(12(20)9(3)4)6-5-7-17-14(16)22/h8-11,15,19,23-24H,5-7H2,1-4H3,(H,18,21)(H3,16,17,22)/t10-,11-/m0/s1 |
| InChIKey | BWJLYHKLZMPLJI-QWRGUYRKSA-N |
| XLogP | 0.90 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|