C21H38ClN5O5 — CID 142572271
N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-2-[5-[(2-chloroacetyl)amino]pentanoylamino]-3-methylbutanamide (PubChem CID 142572271) has the molecular formula C21H38ClN5O5 and a molecular weight of 476.02 g/mol. Its IUPAC name is N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-2-[5-[(2-chloroacetyl)amino]pentanoylamino]-3-methylbutanamide.
| Compound Name | N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-2-[5-[(2-chloroacetyl)amino]pentanoylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 142572271 |
| Molecular Formula | C21H38ClN5O5 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-2-[5-[(2-chloroacetyl)amino]pentanoylamino]-3-methylbutanamide |
| SMILES | CC(C)C(=O)[C@H](CCCNC(N)=O)NC(=O)C(NC(=O)CCCCNC(=O)CCl)C(C)C |
| InChI | InChI=1S/C21H38ClN5O5/c1-13(2)18(27-16(28)9-5-6-10-24-17(29)12-22)20(31)26-15(19(30)14(3)4)8-7-11-25-21(23)32/h13-15,18H,5-12H2,1-4H3,(H,24,29)(H,26,31)(H,27,28)(H3,23,25,32)/t15-,18?/m0/s1 |
| InChIKey | JOUPGPNWPMVGTR-BUSXIPJBSA-N |
| XLogP | 0.81 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|