C18H36N4O3 — CID 149486153
(2S)-2-(tert-butylamino)-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-methylbutanamide (PubChem CID 149486153) has the molecular formula C18H36N4O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (2S)-2-(tert-butylamino)-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-(tert-butylamino)-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 149486153 |
| Molecular Formula | C18H36N4O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | (2S)-2-(tert-butylamino)-N-[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-3-methylbutanamide |
| SMILES | CC(C)C(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(C)(C)C)C(C)C |
| InChI | InChI=1S/C18H36N4O3/c1-11(2)14(22-18(5,6)7)16(24)21-13(15(23)12(3)4)9-8-10-20-17(19)25/h11-14,22H,8-10H2,1-7H3,(H,21,24)(H3,19,20,25)/t13-,14-/m0/s1 |
| InChIKey | ZEEYKLLMCWWVEH-KBPBESRZSA-N |
| XLogP | 1.56 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|