C17H35N5O3 — CID 170038657
(2S)-N-tert-butyl-5-(carbamoylamino)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]pentanamide (PubChem CID 170038657) has the molecular formula C17H35N5O3 and a molecular weight of 357.50 g/mol. Its IUPAC name is (2S)-N-tert-butyl-5-(carbamoylamino)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]pentanamide.
| Compound Name | (2S)-N-tert-butyl-5-(carbamoylamino)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 170038657 |
| Molecular Formula | C17H35N5O3 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (2S)-N-tert-butyl-5-(carbamoylamino)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]pentanamide |
| SMILES | CCN[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)NC(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H35N5O3/c1-7-19-13(11(2)3)15(24)21-12(9-8-10-20-16(18)25)14(23)22-17(4,5)6/h11-13,19H,7-10H2,1-6H3,(H,21,24)(H,22,23)(H3,18,20,25)/t12-,13-/m0/s1 |
| InChIKey | BPNINOASDYLYPZ-STQMWFEESA-N |
| XLogP | 0.47 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|