C18H38N4O3 — CID 178154485
N-[1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methyl-2-(propan-2-ylamino)butanamide;ethane (PubChem CID 178154485) has the molecular formula C18H38N4O3 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methyl-2-(propan-2-ylamino)butanamide;ethane.
| Compound Name | N-[1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methyl-2-(propan-2-ylamino)butanamide;ethane |
|---|---|
| PubChem CID | 178154485 |
| Molecular Formula | C18H38N4O3 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | N-[1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methyl-2-(propan-2-ylamino)butanamide;ethane |
| SMILES | CC.CCC(=O)C(CCCNC(N)=O)NC(=O)C(NC(C)C)C(C)C |
| InChI | InChI=1S/C16H32N4O3.C2H6/c1-6-13(21)12(8-7-9-18-16(17)23)20-15(22)14(10(2)3)19-11(4)5;1-2/h10-12,14,19H,6-9H2,1-5H3,(H,20,22)(H3,17,18,23);1-2H3 |
| InChIKey | FGUBVRSYAHGKPO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|