C14H28N4O3S — CID 166767033
(2S)-N-[(3S)-6-(carbamoylamino)-1-methylsulfanyl-2-oxohexan-3-yl]-3-methyl-2-(methylamino)butanamide (PubChem CID 166767033) has the molecular formula C14H28N4O3S and a molecular weight of 332.47 g/mol. Its IUPAC name is (2S)-N-[(3S)-6-(carbamoylamino)-1-methylsulfanyl-2-oxohexan-3-yl]-3-methyl-2-(methylamino)butanamide.
| Compound Name | (2S)-N-[(3S)-6-(carbamoylamino)-1-methylsulfanyl-2-oxohexan-3-yl]-3-methyl-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 166767033 |
| Molecular Formula | C14H28N4O3S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (2S)-N-[(3S)-6-(carbamoylamino)-1-methylsulfanyl-2-oxohexan-3-yl]-3-methyl-2-(methylamino)butanamide |
| SMILES | CN[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)CSC)C(C)C |
| InChI | InChI=1S/C14H28N4O3S/c1-9(2)12(16-3)13(20)18-10(11(19)8-22-4)6-5-7-17-14(15)21/h9-10,12,16H,5-8H2,1-4H3,(H,18,20)(H3,15,17,21)/t10-,12-/m0/s1 |
| InChIKey | DSMBIYCKCULPRB-JQWIXIFHSA-N |
| XLogP | 0.10 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|