C18H40N4O3 — CID 178057919
N-[1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methyl-2-(methylamino)butanamide;ethane (PubChem CID 178057919) has the molecular formula C18H40N4O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is N-[1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methyl-2-(methylamino)butanamide;ethane.
| Compound Name | N-[1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methyl-2-(methylamino)butanamide;ethane |
|---|---|
| PubChem CID | 178057919 |
| Molecular Formula | C18H40N4O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | N-[1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methyl-2-(methylamino)butanamide;ethane |
| SMILES | CC.CC.CCC(=O)C(CCCNC(N)=O)NC(=O)C(NC)C(C)C |
| InChI | InChI=1S/C14H28N4O3.2C2H6/c1-5-11(19)10(7-6-8-17-14(15)21)18-13(20)12(16-4)9(2)3;2*1-2/h9-10,12,16H,5-8H2,1-4H3,(H,18,20)(H3,15,17,21);2*1-2H3 |
| InChIKey | LOUYDYLERZVWGS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|