C18H35N5O5 — CID 174192697
(2S)-2-[3-(2-aminoethoxy)propanoylamino]-N-[(4S)-1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methylbutanamide (PubChem CID 174192697) has the molecular formula C18H35N5O5 and a molecular weight of 401.51 g/mol. Its IUPAC name is (2S)-2-[3-(2-aminoethoxy)propanoylamino]-N-[(4S)-1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-[3-(2-aminoethoxy)propanoylamino]-N-[(4S)-1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 174192697 |
| Molecular Formula | C18H35N5O5 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | (2S)-2-[3-(2-aminoethoxy)propanoylamino]-N-[(4S)-1-(carbamoylamino)-5-oxoheptan-4-yl]-3-methylbutanamide |
| SMILES | CCC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(=O)CCOCCN)C(C)C |
| InChI | InChI=1S/C18H35N5O5/c1-4-14(24)13(6-5-9-21-18(20)27)22-17(26)16(12(2)3)23-15(25)7-10-28-11-8-19/h12-13,16H,4-11,19H2,1-3H3,(H,22,26)(H,23,25)(H3,20,21,27)/t13-,16-/m0/s1 |
| InChIKey | BEKIAIRJHNDAHN-BBRMVZONSA-N |
| XLogP | -0.60 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|