C20H32N6O7 — CID 142800854
(2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]pentanamide (PubChem CID 142800854) has the molecular formula C20H32N6O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]pentanamide.
| Compound Name | (2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 142800854 |
| Molecular Formula | C20H32N6O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]pentanamide |
| SMILES | CC(C)[C@H](NC(=O)CCOCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCCNC(N)=O)C(N)=O |
| InChI | InChI=1S/C20H32N6O7/c1-12(2)17(19(31)24-13(18(21)30)4-3-8-23-20(22)32)25-14(27)7-10-33-11-9-26-15(28)5-6-16(26)29/h5-6,12-13,17H,3-4,7-11H2,1-2H3,(H2,21,30)(H,24,31)(H,25,27)(H3,22,23,32)/t13-,17-/m0/s1 |
| InChIKey | FBGXHVPBWFKVID-GUYCJALGSA-N |
| XLogP | -2.12 |
| TPSA | 203.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|