C20H32N6O7 — CID 69466849
(2S)-5-(carbamoylamino)-2-[[(2S)-2-[[2-[3-(2,5-dioxopyrrol-1-yl)propylamino]acetyl]amino]-3-methylbutanoyl]amino]pentanoic acid (PubChem CID 69466849) has the molecular formula C20H32N6O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[[(2S)-2-[[2-[3-(2,5-dioxopyrrol-1-yl)propylamino]acetyl]amino]-3-methylbutanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(carbamoylamino)-2-[[(2S)-2-[[2-[3-(2,5-dioxopyrrol-1-yl)propylamino]acetyl]amino]-3-methylbutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 69466849 |
| Molecular Formula | C20H32N6O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[[(2S)-2-[[2-[3-(2,5-dioxopyrrol-1-yl)propylamino]acetyl]amino]-3-methylbutanoyl]amino]pentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CNCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C20H32N6O7/c1-12(2)17(18(30)24-13(19(31)32)5-3-9-23-20(21)33)25-14(27)11-22-8-4-10-26-15(28)6-7-16(26)29/h6-7,12-13,17,22H,3-5,8-11H2,1-2H3,(H,24,30)(H,25,27)(H,31,32)(H3,21,23,33)/t13-,17-/m0/s1 |
| InChIKey | VOKLTLJHBSHEHL-GUYCJALGSA-N |
| XLogP | -1.95 |
| TPSA | 200.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|