C22H35N5O9S — CID 129177854
(2S)-1-[[(2S)-1-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-(2,5-dioxopyrrol-1-yl)-1-oxobutane-2-sulfonic acid (PubChem CID 129177854) has the molecular formula C22H35N5O9S and a molecular weight of 545.62 g/mol. Its IUPAC name is (2S)-1-[[(2S)-1-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-(2,5-dioxopyrrol-1-yl)-1-oxobutane-2-sulfonic acid.
| Compound Name | (2S)-1-[[(2S)-1-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-(2,5-dioxopyrrol-1-yl)-1-oxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 129177854 |
| Molecular Formula | C22H35N5O9S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | (2S)-1-[[(2S)-1-[[(4S)-1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-(2,5-dioxopyrrol-1-yl)-1-oxobutane-2-sulfonic acid |
| SMILES | CC(C)C(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](CCN1C(=O)C=CC1=O)S(=O)(=O)O)C(C)C |
| InChI | InChI=1S/C22H35N5O9S/c1-12(2)18(21(32)25-14(19(30)13(3)4)6-5-10-24-22(23)33)26-20(31)15(37(34,35)36)9-11-27-16(28)7-8-17(27)29/h7-8,12-15,18H,5-6,9-11H2,1-4H3,(H,25,32)(H,26,31)(H3,23,24,33)(H,34,35,36)/t14-,15-,18-/m0/s1 |
| InChIKey | NBJRFDZSTKHFIC-MPGHIAIKSA-N |
| XLogP | -1.14 |
| TPSA | 222.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|