C29H42N6O6 — CID 145294919
N-[1-[[(2S)-5-(carbamoylamino)-1-(4-ethylanilino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide (PubChem CID 145294919) has the molecular formula C29H42N6O6 and a molecular weight of 570.69 g/mol. Its IUPAC name is N-[1-[[(2S)-5-(carbamoylamino)-1-(4-ethylanilino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide.
| Compound Name | N-[1-[[(2S)-5-(carbamoylamino)-1-(4-ethylanilino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 145294919 |
| Molecular Formula | C29H42N6O6 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | N-[1-[[(2S)-5-(carbamoylamino)-1-(4-ethylanilino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| SMILES | CCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)C(NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C29H42N6O6/c1-4-20-11-13-21(14-12-20)32-27(39)22(9-8-17-31-29(30)41)33-28(40)26(19(2)3)34-23(36)10-6-5-7-18-35-24(37)15-16-25(35)38/h11-16,19,22,26H,4-10,17-18H2,1-3H3,(H,32,39)(H,33,40)(H,34,36)(H3,30,31,41)/t22-,26?/m0/s1 |
| InChIKey | FVJLQODYIOCCQN-CHQVSRGASA-N |
| XLogP | 1.75 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|