C27H37ClN6O7 — CID 167089277
(2S)-5-(carbamoylamino)-N-[4-(chloromethyl)phenyl]-2-[[(2R)-2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]pentanamide (PubChem CID 167089277) has the molecular formula C27H37ClN6O7 and a molecular weight of 593.08 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-N-[4-(chloromethyl)phenyl]-2-[[(2R)-2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]pentanamide.
| Compound Name | (2S)-5-(carbamoylamino)-N-[4-(chloromethyl)phenyl]-2-[[(2R)-2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 167089277 |
| Molecular Formula | C27H37ClN6O7 |
| Molecular Weight | 593.08 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | (2S)-5-(carbamoylamino)-N-[4-(chloromethyl)phenyl]-2-[[(2R)-2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]-3-methylbutanoyl]amino]pentanamide |
| SMILES | CC(C)[C@@H](NC(=O)CCOCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CCl)cc1 |
| InChI | InChI=1S/C27H37ClN6O7/c1-17(2)24(33-21(35)11-14-41-15-13-34-22(36)9-10-23(34)37)26(39)32-20(4-3-12-30-27(29)40)25(38)31-19-7-5-18(16-28)6-8-19/h5-10,17,20,24H,3-4,11-16H2,1-2H3,(H,31,38)(H,32,39)(H,33,35)(H3,29,30,40)/t20-,24+/m0/s1 |
| InChIKey | QEPVGTDKOYYVGM-GBXCKJPGSA-N |
| XLogP | 0.77 |
| TPSA | 189.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.08 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|