C28H39N7O8 — CID 144940719
[4-[[5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl nitrite (PubChem CID 144940719) has the molecular formula C28H39N7O8 and a molecular weight of 601.66 g/mol. Its IUPAC name is [4-[[5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl nitrite.
| Compound Name | [4-[[5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl nitrite |
|---|---|
| PubChem CID | 144940719 |
| Molecular Formula | C28H39N7O8 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | [4-[[5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl nitrite |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(CON=O)cc1 |
| InChI | InChI=1S/C28H39N7O8/c1-18(2)25(33-22(36)8-4-3-5-16-35-23(37)13-14-24(35)38)27(40)32-21(7-6-15-30-28(29)41)26(39)31-20-11-9-19(10-12-20)17-43-34-42/h9-14,18,21,25H,3-8,15-17H2,1-2H3,(H,31,39)(H,32,40)(H,33,36)(H3,29,30,41)/t21?,25-/m0/s1 |
| InChIKey | QEVFNHFNAXBISP-QBGQUKIHSA-N |
| XLogP | 1.38 |
| TPSA | 218.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|