C20H31N5O6 — CID 142599415
N-[1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide (PubChem CID 142599415) has the molecular formula C20H31N5O6 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide.
| Compound Name | N-[1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 142599415 |
| Molecular Formula | C20H31N5O6 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-[1-(carbamoylamino)-6-methyl-5-oxoheptan-4-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide |
| SMILES | CC(C)C(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)CN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C20H31N5O6/c1-11(2)17(24-14(26)10-25-15(27)7-8-16(25)28)19(30)23-13(18(29)12(3)4)6-5-9-22-20(21)31/h7-8,11-13,17H,5-6,9-10H2,1-4H3,(H,23,30)(H,24,26)(H3,21,22,31) |
| InChIKey | IZKLZSYPDRREPK-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|