C15H21N5O6 — CID 154936809
N-[6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetamide (PubChem CID 154936809) has the molecular formula C15H21N5O6 and a molecular weight of 367.36 g/mol. Its IUPAC name is N-[6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetamide.
| Compound Name | N-[6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 154936809 |
| Molecular Formula | C15H21N5O6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetamide |
| SMILES | CC(=O)C(CCCNC(N)=O)NC(=O)CNC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H21N5O6/c1-9(21)10(3-2-6-17-15(16)26)19-11(22)7-18-12(23)8-20-13(24)4-5-14(20)25/h4-5,10H,2-3,6-8H2,1H3,(H,18,23)(H,19,22)(H3,16,17,26) |
| InChIKey | GBAKMSIPIFMNOX-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|