C20H34Br2N4O6 — CID 130295738
[7-[[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]amino]-7-oxoheptan-2-yl] 3-bromo-2-(bromomethyl)propanoate (PubChem CID 130295738) has the molecular formula C20H34Br2N4O6 and a molecular weight of 586.32 g/mol. Its IUPAC name is [7-[[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]amino]-7-oxoheptan-2-yl] 3-bromo-2-(bromomethyl)propanoate.
| Compound Name | [7-[[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]amino]-7-oxoheptan-2-yl] 3-bromo-2-(bromomethyl)propanoate |
|---|---|
| PubChem CID | 130295738 |
| Molecular Formula | C20H34Br2N4O6 |
| Molecular Weight | 586.32 g/mol |
| Exact Mass | 584.08 |
| IUPAC Name | [7-[[2-[[6-(carbamoylamino)-2-oxohexan-3-yl]amino]-2-oxoethyl]amino]-7-oxoheptan-2-yl] 3-bromo-2-(bromomethyl)propanoate |
| SMILES | CC(=O)C(CCCNC(N)=O)NC(=O)CNC(=O)CCCCC(C)OC(=O)C(CBr)CBr |
| InChI | InChI=1S/C20H34Br2N4O6/c1-13(32-19(30)15(10-21)11-22)6-3-4-8-17(28)25-12-18(29)26-16(14(2)27)7-5-9-24-20(23)31/h13,15-16H,3-12H2,1-2H3,(H,25,28)(H,26,29)(H3,23,24,31) |
| InChIKey | FDQIVOPSDGNKAR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|