C24H37N5O6 — CID 168954345
N-[2-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-2-oxoethyl]-8-oxononanamide (PubChem CID 168954345) has the molecular formula C24H37N5O6 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[2-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-2-oxoethyl]-8-oxononanamide.
| Compound Name | N-[2-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-2-oxoethyl]-8-oxononanamide |
|---|---|
| PubChem CID | 168954345 |
| Molecular Formula | C24H37N5O6 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | N-[2-[[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-2-oxoethyl]-8-oxononanamide |
| SMILES | CC(=O)CCCCCCC(=O)NCC(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C24H37N5O6/c1-17(31)7-4-2-3-5-9-21(32)27-15-22(33)29-20(8-6-14-26-24(25)35)23(34)28-19-12-10-18(16-30)11-13-19/h10-13,20,30H,2-9,14-16H2,1H3,(H,27,32)(H,28,34)(H,29,33)(H3,25,26,35) |
| InChIKey | USVHSBMXMXRNKO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 179.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|