C29H45N7O8 — CID 138527336
N-[2-[[(2S)-1-[4-[(6-acetamidohexanoylamino)oxymethyl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-5-oxohexanamide (PubChem CID 138527336) has the molecular formula C29H45N7O8 and a molecular weight of 619.72 g/mol. Its IUPAC name is N-[2-[[(2S)-1-[4-[(6-acetamidohexanoylamino)oxymethyl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-5-oxohexanamide.
| Compound Name | N-[2-[[(2S)-1-[4-[(6-acetamidohexanoylamino)oxymethyl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-5-oxohexanamide |
|---|---|
| PubChem CID | 138527336 |
| Molecular Formula | C29H45N7O8 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | N-[2-[[(2S)-1-[4-[(6-acetamidohexanoylamino)oxymethyl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-5-oxohexanamide |
| SMILES | CC(=O)CCCC(=O)NCC(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CONC(=O)CCCCCNC(C)=O)cc1 |
| InChI | InChI=1S/C29H45N7O8/c1-20(37)8-6-11-25(39)33-18-27(41)35-24(9-7-17-32-29(30)43)28(42)34-23-14-12-22(13-15-23)19-44-36-26(40)10-4-3-5-16-31-21(2)38/h12-15,24H,3-11,16-19H2,1-2H3,(H,31,38)(H,33,39)(H,34,42)(H,35,41)(H,36,40)(H3,30,32,43)/t24-/m0/s1 |
| InChIKey | CMYUKNMWBWYXIO-DEOSSOPVSA-N |
| XLogP | 0.68 |
| TPSA | 226.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|