C23H37N5O5 — CID 166895416
N-[[4-[[2-formamido-5-(methylamino)pentanoyl]amino]phenyl]methoxy]-6-(propanoylamino)hexanamide (PubChem CID 166895416) has the molecular formula C23H37N5O5 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[[4-[[2-formamido-5-(methylamino)pentanoyl]amino]phenyl]methoxy]-6-(propanoylamino)hexanamide.
| Compound Name | N-[[4-[[2-formamido-5-(methylamino)pentanoyl]amino]phenyl]methoxy]-6-(propanoylamino)hexanamide |
|---|---|
| PubChem CID | 166895416 |
| Molecular Formula | C23H37N5O5 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[[4-[[2-formamido-5-(methylamino)pentanoyl]amino]phenyl]methoxy]-6-(propanoylamino)hexanamide |
| SMILES | CCC(=O)NCCCCCC(=O)NOCc1ccc(NC(=O)C(CCCNC)NC=O)cc1 |
| InChI | InChI=1S/C23H37N5O5/c1-3-21(30)25-15-6-4-5-9-22(31)28-33-16-18-10-12-19(13-11-18)27-23(32)20(26-17-29)8-7-14-24-2/h10-13,17,20,24H,3-9,14-16H2,1-2H3,(H,25,30)(H,26,29)(H,27,32)(H,28,31) |
| InChIKey | PSNJNIHDSHGBHF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|