C30H35N3O4 — CID 10951210
N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-phenylmethoxyoctanediamide (PubChem CID 10951210) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-phenylmethoxyoctanediamide.
| Compound Name | N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-phenylmethoxyoctanediamide |
|---|---|
| PubChem CID | 10951210 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | N-[(2S)-1-anilino-1-oxo-3-phenylpropan-2-yl]-N'-phenylmethoxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccccc1)NOCc1ccccc1 |
| InChI | InChI=1S/C30H35N3O4/c34-28(20-12-1-2-13-21-29(35)33-37-23-25-16-8-4-9-17-25)32-27(22-24-14-6-3-7-15-24)30(36)31-26-18-10-5-11-19-26/h3-11,14-19,27H,1-2,12-13,20-23H2,(H,31,36)(H,32,34)(H,33,35)/t27-/m0/s1 |
| InChIKey | ORXGQBNTAHCUPV-MHZLTWQESA-N |
| XLogP | 4.94 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|