C36H54N4O5 — CID 167691462
[4-[[(2S)-6-amino-2-[[(2S)-2-(8-methylnonanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methyl 2-methylpropanoate (PubChem CID 167691462) has the molecular formula C36H54N4O5 and a molecular weight of 622.85 g/mol. Its IUPAC name is [4-[[(2S)-6-amino-2-[[(2S)-2-(8-methylnonanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methyl 2-methylpropanoate.
| Compound Name | [4-[[(2S)-6-amino-2-[[(2S)-2-(8-methylnonanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 167691462 |
| Molecular Formula | C36H54N4O5 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.41 |
| IUPAC Name | [4-[[(2S)-6-amino-2-[[(2S)-2-(8-methylnonanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methyl 2-methylpropanoate |
| SMILES | CC(C)CCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)Nc1ccc(COC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C36H54N4O5/c1-26(2)14-8-5-6-11-18-33(41)39-32(24-28-15-9-7-10-16-28)35(43)40-31(17-12-13-23-37)34(42)38-30-21-19-29(20-22-30)25-45-36(44)27(3)4/h7,9-10,15-16,19-22,26-27,31-32H,5-6,8,11-14,17-18,23-25,37H2,1-4H3,(H,38,42)(H,39,41)(H,40,43)/t31-,32-/m0/s1 |
| InChIKey | WZXYBVMJYLKVFR-ACHIHNKUSA-N |
| XLogP | 5.66 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|