C26H37N5O4 — CID 59265060
(2R)-6-amino-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-N-[4-(methoxymethyl)phenyl]hexanamide (PubChem CID 59265060) has the molecular formula C26H37N5O4 and a molecular weight of 483.61 g/mol. Its IUPAC name is (2R)-6-amino-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-N-[4-(methoxymethyl)phenyl]hexanamide.
| Compound Name | (2R)-6-amino-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-N-[4-(methoxymethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 59265060 |
| Molecular Formula | C26H37N5O4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | (2R)-6-amino-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-N-[4-(methoxymethyl)phenyl]hexanamide |
| SMILES | COCc1ccc(NC(=O)[C@@H](CCCCN)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](C)N)cc1 |
| InChI | InChI=1S/C26H37N5O4/c1-18(28)24(32)31-23(16-19-8-4-3-5-9-19)26(34)30-22(10-6-7-15-27)25(33)29-21-13-11-20(12-14-21)17-35-2/h3-5,8-9,11-14,18,22-23H,6-7,10,15-17,27-28H2,1-2H3,(H,29,33)(H,30,34)(H,31,32)/t18-,22-,23+/m1/s1 |
| InChIKey | NICMEMNDVIBTBU-YSZBQJHXSA-N |
| XLogP | 1.46 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|