C41H49N7O7 — CID 70899415
[4-[[4-[[(2S)-6-amino-2-[[2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methoxycarbonylamino]phenyl]methyl N-(4-methylphenyl)carbamate (PubChem CID 70899415) has the molecular formula C41H49N7O7 and a molecular weight of 751.89 g/mol. Its IUPAC name is [4-[[4-[[(2S)-6-amino-2-[[2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methoxycarbonylamino]phenyl]methyl N-(4-methylphenyl)carbamate.
| Compound Name | [4-[[4-[[(2S)-6-amino-2-[[2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methoxycarbonylamino]phenyl]methyl N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 70899415 |
| Molecular Formula | C41H49N7O7 |
| Molecular Weight | 751.89 g/mol |
| Exact Mass | 751.37 |
| IUPAC Name | [4-[[4-[[(2S)-6-amino-2-[[2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methoxycarbonylamino]phenyl]methyl N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)OCc2ccc(NC(=O)OCc3ccc(NC(=O)[C@H](CCCCN)NC(=O)C(Cc4ccccc4)NC(=O)[C@@H](C)N)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H49N7O7/c1-27-11-17-33(18-12-27)45-40(52)54-26-31-15-21-34(22-16-31)46-41(53)55-25-30-13-19-32(20-14-30)44-38(50)35(10-6-7-23-42)47-39(51)36(48-37(49)28(2)43)24-29-8-4-3-5-9-29/h3-5,8-9,11-22,28,35-36H,6-7,10,23-26,42-43H2,1-2H3,(H,44,50)(H,45,52)(H,46,53)(H,47,51)(H,48,49)/t28-,35+,36?/m1/s1 |
| InChIKey | NHGVFZASHWNKNS-VKJZQBAESA-N |
| XLogP | 5.12 |
| TPSA | 216.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|