C27H38N4O4 — CID 163515152
[4-[[(2S)-6-amino-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methyl 2-methylpropanoate (PubChem CID 163515152) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is [4-[[(2S)-6-amino-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methyl 2-methylpropanoate.
| Compound Name | [4-[[(2S)-6-amino-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 163515152 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | [4-[[(2S)-6-amino-2-[[(2S)-2-(methylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]phenyl]methyl 2-methylpropanoate |
| SMILES | CN[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)Nc1ccc(COC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C27H38N4O4/c1-19(2)27(34)35-18-21-12-14-22(15-13-21)30-25(32)23(11-7-8-16-28)31-26(33)24(29-3)17-20-9-5-4-6-10-20/h4-6,9-10,12-15,19,23-24,29H,7-8,11,16-18,28H2,1-3H3,(H,30,32)(H,31,33)/t23-,24-/m0/s1 |
| InChIKey | DGBCRHHJPRINIZ-ZEQRLZLVSA-N |
| XLogP | 2.77 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|