C28H39N3O4 — CID 148651782
[4-[[(2R,5S)-2-(4-aminobutyl)-4-oxo-6-phenyl-5-(propan-2-ylamino)hexanoyl]amino]phenyl]methyl acetate (PubChem CID 148651782) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is [4-[[(2R,5S)-2-(4-aminobutyl)-4-oxo-6-phenyl-5-(propan-2-ylamino)hexanoyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[(2R,5S)-2-(4-aminobutyl)-4-oxo-6-phenyl-5-(propan-2-ylamino)hexanoyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 148651782 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | [4-[[(2R,5S)-2-(4-aminobutyl)-4-oxo-6-phenyl-5-(propan-2-ylamino)hexanoyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)[C@H](CCCCN)CC(=O)[C@H](Cc2ccccc2)NC(C)C)cc1 |
| InChI | InChI=1S/C28H39N3O4/c1-20(2)30-26(17-22-9-5-4-6-10-22)27(33)18-24(11-7-8-16-29)28(34)31-25-14-12-23(13-15-25)19-35-21(3)32/h4-6,9-10,12-15,20,24,26,30H,7-8,11,16-19,29H2,1-3H3,(H,31,34)/t24-,26+/m1/s1 |
| InChIKey | NMAZDGYOKQISSK-RSXGOPAZSA-N |
| XLogP | 4.00 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|