C25H35N5O3 — CID 135202870
6-amino-2-[[(2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-N-(4-methylphenyl)hexanamide (PubChem CID 135202870) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is 6-amino-2-[[(2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-N-(4-methylphenyl)hexanamide.
| Compound Name | 6-amino-2-[[(2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-N-(4-methylphenyl)hexanamide |
|---|---|
| PubChem CID | 135202870 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 6-amino-2-[[(2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanoyl]amino]-N-(4-methylphenyl)hexanamide |
| SMILES | Cc1ccc(NC(=O)C(CCCCN)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](C)N)cc1 |
| InChI | InChI=1S/C25H35N5O3/c1-17-11-13-20(14-12-17)28-24(32)21(10-6-7-15-26)29-25(33)22(30-23(31)18(2)27)16-19-8-4-3-5-9-19/h3-5,8-9,11-14,18,21-22H,6-7,10,15-16,26-27H2,1-2H3,(H,28,32)(H,29,33)(H,30,31)/t18-,21?,22+/m0/s1 |
| InChIKey | SQZIIYQHACYUNP-IDTFUIECSA-N |
| XLogP | 1.62 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|