C19H31Cl2FN4O3 — CID 131865494
N-(7-amino-1-fluoro-2-oxoheptan-3-yl)-2-(2-aminopropanoylamino)-3-phenylpropanamide;dihydrochloride (PubChem CID 131865494) has the molecular formula C19H31Cl2FN4O3 and a molecular weight of 453.39 g/mol. Its IUPAC name is N-(7-amino-1-fluoro-2-oxoheptan-3-yl)-2-(2-aminopropanoylamino)-3-phenylpropanamide;dihydrochloride.
| Compound Name | N-(7-amino-1-fluoro-2-oxoheptan-3-yl)-2-(2-aminopropanoylamino)-3-phenylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 131865494 |
| Molecular Formula | C19H31Cl2FN4O3 |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-(7-amino-1-fluoro-2-oxoheptan-3-yl)-2-(2-aminopropanoylamino)-3-phenylpropanamide;dihydrochloride |
| SMILES | CC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)CF.Cl.Cl |
| InChI | InChI=1S/C19H29FN4O3.2ClH/c1-13(22)18(26)24-16(11-14-7-3-2-4-8-14)19(27)23-15(17(25)12-20)9-5-6-10-21;;/h2-4,7-8,13,15-16H,5-6,9-12,21-22H2,1H3,(H,23,27)(H,24,26);2*1H |
| InChIKey | OPOZBNXNDHXCAT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|