C27H36N4O6 — CID 158750770
benzyl N-[9-(carbamoylamino)-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methyl-4-oxononan-3-yl]carbamate (PubChem CID 158750770) has the molecular formula C27H36N4O6 and a molecular weight of 512.61 g/mol. Its IUPAC name is benzyl N-[9-(carbamoylamino)-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methyl-4-oxononan-3-yl]carbamate.
| Compound Name | benzyl N-[9-(carbamoylamino)-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methyl-4-oxononan-3-yl]carbamate |
|---|---|
| PubChem CID | 158750770 |
| Molecular Formula | C27H36N4O6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | benzyl N-[9-(carbamoylamino)-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methyl-4-oxononan-3-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)CC(CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C27H36N4O6/c1-18(2)24(31-27(36)37-17-20-7-4-3-5-8-20)23(33)15-21(9-6-14-29-26(28)35)25(34)30-22-12-10-19(16-32)11-13-22/h3-5,7-8,10-13,18,21,24,32H,6,9,14-17H2,1-2H3,(H,30,34)(H,31,36)(H3,28,29,35) |
| InChIKey | NWIPQFJUJVWSJE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|