C24H38N4O6 — CID 157104544
tert-butyl N-[(3S,6R)-9-(carbamoylamino)-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methyl-4-oxononan-3-yl]carbamate (PubChem CID 157104544) has the molecular formula C24H38N4O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is tert-butyl N-[(3S,6R)-9-(carbamoylamino)-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methyl-4-oxononan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,6R)-9-(carbamoylamino)-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methyl-4-oxononan-3-yl]carbamate |
|---|---|
| PubChem CID | 157104544 |
| Molecular Formula | C24H38N4O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | tert-butyl N-[(3S,6R)-9-(carbamoylamino)-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methyl-4-oxononan-3-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)C[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C24H38N4O6/c1-15(2)20(28-23(33)34-24(3,4)5)19(30)13-17(7-6-12-26-22(25)32)21(31)27-18-10-8-16(14-29)9-11-18/h8-11,15,17,20,29H,6-7,12-14H2,1-5H3,(H,27,31)(H,28,33)(H3,25,26,32)/t17-,20+/m1/s1 |
| InChIKey | ISWFOZBTRUJMHS-XLIONFOSSA-N |
| XLogP | 2.69 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|