C22H34N4O4 — CID 158648208
(2R)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-(4-ethylphenyl)-6-methyl-4-oxoheptanamide (PubChem CID 158648208) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is (2R)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-(4-ethylphenyl)-6-methyl-4-oxoheptanamide.
| Compound Name | (2R)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-(4-ethylphenyl)-6-methyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 158648208 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (2R)-5-acetamido-2-[3-(carbamoylamino)propyl]-N-(4-ethylphenyl)-6-methyl-4-oxoheptanamide |
| SMILES | CCc1ccc(NC(=O)[C@H](CCCNC(N)=O)CC(=O)C(NC(C)=O)C(C)C)cc1 |
| InChI | InChI=1S/C22H34N4O4/c1-5-16-8-10-18(11-9-16)26-21(29)17(7-6-12-24-22(23)30)13-19(28)20(14(2)3)25-15(4)27/h8-11,14,17,20H,5-7,12-13H2,1-4H3,(H,25,27)(H,26,29)(H3,23,24,30)/t17-,20?/m1/s1 |
| InChIKey | IBFNBHIKBLUAAU-DIAVIDTQSA-N |
| XLogP | 2.37 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|