C30H50N4O5 — CID 163499254
(2R,5S)-2-[3-(carbamoylamino)propyl]-5-[3-(4,4-dimethylpentoxy)propanoylamino]-N-(4-ethylphenyl)-6-methyl-4-oxoheptanamide (PubChem CID 163499254) has the molecular formula C30H50N4O5 and a molecular weight of 546.75 g/mol. Its IUPAC name is (2R,5S)-2-[3-(carbamoylamino)propyl]-5-[3-(4,4-dimethylpentoxy)propanoylamino]-N-(4-ethylphenyl)-6-methyl-4-oxoheptanamide.
| Compound Name | (2R,5S)-2-[3-(carbamoylamino)propyl]-5-[3-(4,4-dimethylpentoxy)propanoylamino]-N-(4-ethylphenyl)-6-methyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 163499254 |
| Molecular Formula | C30H50N4O5 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | (2R,5S)-2-[3-(carbamoylamino)propyl]-5-[3-(4,4-dimethylpentoxy)propanoylamino]-N-(4-ethylphenyl)-6-methyl-4-oxoheptanamide |
| SMILES | CCc1ccc(NC(=O)[C@H](CCCNC(N)=O)CC(=O)[C@@H](NC(=O)CCOCCCC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C30H50N4O5/c1-7-22-11-13-24(14-12-22)33-28(37)23(10-8-17-32-29(31)38)20-25(35)27(21(2)3)34-26(36)15-19-39-18-9-16-30(4,5)6/h11-14,21,23,27H,7-10,15-20H2,1-6H3,(H,33,37)(H,34,36)(H3,31,32,38)/t23-,27+/m1/s1 |
| InChIKey | YYESYIXNLCKZEF-KCWPFWIISA-N |
| XLogP | 4.59 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|