C27H40N4O7 — CID 147154379
[4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxo-5-(6-oxoheptanoylamino)heptanoyl]amino]phenyl]methyl deuterioformate (PubChem CID 147154379) has the molecular formula C27H40N4O7 and a molecular weight of 533.64 g/mol. Its IUPAC name is [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxo-5-(6-oxoheptanoylamino)heptanoyl]amino]phenyl]methyl deuterioformate.
| Compound Name | [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxo-5-(6-oxoheptanoylamino)heptanoyl]amino]phenyl]methyl deuterioformate |
|---|---|
| PubChem CID | 147154379 |
| Molecular Formula | C27H40N4O7 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxo-5-(6-oxoheptanoylamino)heptanoyl]amino]phenyl]methyl deuterioformate |
| SMILES | [2H]C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)CC(=O)[C@@H](NC(=O)CCCCC(C)=O)C(C)C)cc1 |
| InChI | InChI=1S/C27H40N4O7/c1-18(2)25(31-24(35)9-5-4-7-19(3)33)23(34)15-21(8-6-14-29-27(28)37)26(36)30-22-12-10-20(11-13-22)16-38-17-32/h10-13,17-18,21,25H,4-9,14-16H2,1-3H3,(H,30,36)(H,31,35)(H3,28,29,37)/t21-,25+/m1/s1/i17D |
| InChIKey | BUPJROVAFHUUKC-VHEISTATSA-N |
| XLogP | 2.61 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|