C34H49N5O10 — CID 165072089
[4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-5-[3-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)-4-oxohexoxy]propanoylamino]-4-oxoheptanoyl]amino]phenyl]methyl deuterioformate (PubChem CID 165072089) has the molecular formula C34H49N5O10 and a molecular weight of 688.80 g/mol. Its IUPAC name is [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-5-[3-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)-4-oxohexoxy]propanoylamino]-4-oxoheptanoyl]amino]phenyl]methyl deuterioformate.
| Compound Name | [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-5-[3-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)-4-oxohexoxy]propanoylamino]-4-oxoheptanoyl]amino]phenyl]methyl deuterioformate |
|---|---|
| PubChem CID | 165072089 |
| Molecular Formula | C34H49N5O10 |
| Molecular Weight | 688.80 g/mol |
| Exact Mass | 688.35 |
| IUPAC Name | [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-6-methyl-5-[3-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)-4-oxohexoxy]propanoylamino]-4-oxoheptanoyl]amino]phenyl]methyl deuterioformate |
| SMILES | [2H]C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)CC(=O)[C@@H](NC(=O)CCOCCCC(=O)CCN2C(=O)CC(C)C2=O)C(C)C)cc1 |
| InChI | InChI=1S/C34H49N5O10/c1-22(2)31(38-29(43)13-17-48-16-5-7-27(41)12-15-39-30(44)18-23(3)33(39)46)28(42)19-25(6-4-14-36-34(35)47)32(45)37-26-10-8-24(9-11-26)20-49-21-40/h8-11,21-23,25,31H,4-7,12-20H2,1-3H3,(H,37,45)(H,38,43)(H3,35,36,47)/t23?,25-,31+/m1/s1/i21D |
| InChIKey | SXYWNXRDFRKQDI-OJJTUWKZSA-N |
| XLogP | 2.00 |
| TPSA | 220.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.80 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|