C24H40N4O6 — CID 160543460
N-[(3S,6R)-9-(carbamoylamino)-6-(2-deuterioacetyl)-2-methyl-4-oxononan-3-yl]-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanamide (PubChem CID 160543460) has the molecular formula C24H40N4O6 and a molecular weight of 481.61 g/mol. Its IUPAC name is N-[(3S,6R)-9-(carbamoylamino)-6-(2-deuterioacetyl)-2-methyl-4-oxononan-3-yl]-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanamide.
| Compound Name | N-[(3S,6R)-9-(carbamoylamino)-6-(2-deuterioacetyl)-2-methyl-4-oxononan-3-yl]-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanamide |
|---|---|
| PubChem CID | 160543460 |
| Molecular Formula | C24H40N4O6 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | N-[(3S,6R)-9-(carbamoylamino)-6-(2-deuterioacetyl)-2-methyl-4-oxononan-3-yl]-6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanamide |
| SMILES | [2H]CC(=O)[C@H](CCCNC(N)=O)CC(=O)[C@@H](NC(=O)CCCCCN1C(=O)CC(C)C1=O)C(C)C |
| InChI | InChI=1S/C24H40N4O6/c1-15(2)22(19(30)14-18(17(4)29)9-8-11-26-24(25)34)27-20(31)10-6-5-7-12-28-21(32)13-16(3)23(28)33/h15-16,18,22H,5-14H2,1-4H3,(H,27,31)(H3,25,26,34)/t16?,18-,22+/m1/s1/i4D |
| InChIKey | FFSFZPPLSZJNPV-XHQWCDMGSA-N |
| XLogP | 1.70 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|