C25H42N4O6 — CID 158806489
N-[(3S,6R)-6-[3-(carbamoylamino)propyl]-2,8-dimethyl-4,7-dioxononan-3-yl]-6-(2,5-dioxopyrrolidin-1-yl)hexanamide (PubChem CID 158806489) has the molecular formula C25H42N4O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is N-[(3S,6R)-6-[3-(carbamoylamino)propyl]-2,8-dimethyl-4,7-dioxononan-3-yl]-6-(2,5-dioxopyrrolidin-1-yl)hexanamide.
| Compound Name | N-[(3S,6R)-6-[3-(carbamoylamino)propyl]-2,8-dimethyl-4,7-dioxononan-3-yl]-6-(2,5-dioxopyrrolidin-1-yl)hexanamide |
|---|---|
| PubChem CID | 158806489 |
| Molecular Formula | C25H42N4O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | N-[(3S,6R)-6-[3-(carbamoylamino)propyl]-2,8-dimethyl-4,7-dioxononan-3-yl]-6-(2,5-dioxopyrrolidin-1-yl)hexanamide |
| SMILES | CC(C)C(=O)[C@H](CCCNC(N)=O)CC(=O)[C@@H](NC(=O)CCCCCN1C(=O)CCC1=O)C(C)C |
| InChI | InChI=1S/C25H42N4O6/c1-16(2)23(19(30)15-18(24(34)17(3)4)9-8-13-27-25(26)35)28-20(31)10-6-5-7-14-29-21(32)11-12-22(29)33/h16-18,23H,5-15H2,1-4H3,(H,28,31)(H3,26,27,35)/t18-,23+/m1/s1 |
| InChIKey | JDNVMCYLHCWNNS-JPYJTQIMSA-N |
| XLogP | 2.09 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|